Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 4-PPBP: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 425872022 of page 4-PPBP for the Chem/Drugbox validation project (updated: 'CASNo').
 
m →‎top: ce formatting
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:4-PPBP|oldid=425872022}} 425872022] of page [[4-PPBP]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 413273487
| Watchedfields = changed
⚫
|ImageFile=4-phenyl-1-(4-phenylbutyl) piperidine.svg
⚫
| verifiedrevid =
⚫
|ImageSize=
|IUPACName=4-phenyl-1-(4-phenylbutyl) piperidine
|=4-phenyl-1-(4-phenylbutyl) piperidine
⚫
|ImageSize=
⚫
|OtherNames=
| ImageAlt = Skeletal formula of 4-PPBP
⚫
|Section1= {{Chembox Identifiers
| ImageFile1 = 4-PPBP-3D-balls.png
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ImageSize1 = 250
| ImageAlt1 = Ball-and-stick model of the 4-PPBP molecule
⚫
| =4--1-(4-phenylbutyl)piperidine
⚫
|OtherNames=
⚫
|Section1={{Chembox Identifiers
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2299855
| ChemSpiderID = 2299855
| InChI = 1/C21H27N/c1-3-9-19(10-4-1)11-7-8-16-22-17-14-21(15-18-22)20-12-5-2-6-13-20/h1-6,9-10,12-13,21H,7-8,11,14-18H2
| InChI = 1/C21H27N/c1-3-9-19(10-4-1)11-7-8-16-22-17-14-21(15-18-22)20-12-5-2-6-13-20/h1-6,9-10,12-13,21H,7-8,11,14-18H2
Line 18: Line 23:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HQGDPZPNAXRCSA-UHFFFAOYSA-N
| StdInChIKey = HQGDPZPNAXRCSA-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 136534-70-8 -->
| CASNo=136534-70-8
⚫
| PubChem=3035672
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| SMILES=C1CN(CCC1C2=CC=CC=C2) CCCCC3=CC=CC=C3
| UNII = HDL2DSB8CH
⚫
| MeSHName=4-phenyl-1-(4-phenylbutyl)piperidine
⚫
| PubChem=3035672
⚫
| SMILES=C1CN(CCC1C2=CC=CC=C2)CCCCC3=CC=CC=C3
⚫
|=4-phenyl-1-(4-phenylbutyl)piperidine
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| Formula=C<sub>21</sub>H<sub>27</sub>N
| Formula=
| C=21 | H=27 | N=1
| MolarMass=293.446 g/mol
| MolarMass=293.446 g/mol
| Appearance=
| Density=
| =
| MeltingPt=
| =
| BoilingPt=
| =
| Solubility=
| =
| Solubility=
}}
}}
|Section3= {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards=
| MainHazards=
| FlashPt=
| FlashPt=
| AutoignitionPt =
| Autoignition=
}}
}}
}}
}}

'''4-PPBP''' is a [[neuroprotective]] [[cyclic amine]] which binds to [[sigma receptor]]s.<ref>{{cite journal | vauthors = Yang S, Bhardwaj A, Cheng J, Alkayed NJ, Hurn PD, Kirsch JR | title = Sigma receptor agonists provide neuroprotection in vitro by preserving bcl-2 | journal = Anesthesia and Analgesia | volume = 104 | issue = 5 | pages = 1179–84, tables of contents | date = May 2007 | pmid = 17456670 | pmc = 2596726 | doi = 10.1213/01.ane.0000260267.71185.73 }}</ref>

4-PPBP decreases [[neuronal nitric oxide synthase]] (nNOS) activity and [[ischemia]]-evoked [[nitric oxide]] (NO) production. 4-PPBP provides [[neuroprotection]]; this involves the prevention of ischemia-induced intracellular Ca<sup>2+</sup> dysregulation.<ref>{{cite journal | vauthors = Yang ZJ, Carter EL, Torbey MT, Martin LJ, Koehler RC | title = Sigma receptor ligand 4-phenyl-1-(4-phenylbutyl)-piperidine modulates neuronal nitric oxide synthase/postsynaptic density-95 coupling mechanisms and protects against neonatal ischemic degeneration of striatal neurons | journal = Experimental Neurology | volume = 221 | issue = 1 | pages = 166–74 | date = January 2010 | pmid = 19883643 | pmc = 2812675 | doi = 10.1016/j.expneurol.2009.10.019 }}</ref> 4-PPBP protects neurons using a mechanism that activates the [[transcription factor]] [[cyclic adenosine monophosphate]] response element-binding protein ([[CREB]]). Neuroprotection that is associated with 4-PPBP increases [[Bcl-2]] expression; Bcl-2 expression is regulated by CREB.<ref>{{cite journal | vauthors = Yang S, Alkayed NJ, Hurn PD, Kirsch JR | title = Cyclic adenosine monophosphate response element-binding protein phosphorylation and neuroprotection by 4-phenyl-1-(4-phenylbutyl) piperidine (PPBP) | journal = Anesthesia and Analgesia | volume = 108 | issue = 3 | pages = 964–70 | date = March 2009 | pmid = 19224810 | pmc = 2828492 | doi = 10.1213/ane.0b013e318192442c }}</ref>

== See also ==
* [[3-PPP]]

== References ==
{{reflist}}

{{Sigma receptor modulators}}

{{DEFAULTSORT:PPBP}}
[[Category:4-Phenylpiperidines]]
[[Category:Sigma agonists]]


{{biochem-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"