Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Balofloxacin: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 477353269 of page Balofloxacin for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Ozzie10aaaa (talk | contribs) m Cleaned up using AutoEd |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Balofloxacin|oldid=477353269}} 477353269] of page [[Balofloxacin]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = |
||
| IUPAC_name = 1- |
| IUPAC_name = 1--6-fluoro-8-methoxy-7-(3-methylaminopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
||
| image = Balofloxacin. |
| image = Balofloxacin. |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite||??}} |
||
| CAS_number = |
| CAS_number = 127294-70-6 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| ChEMBL_Ref = {{ebicite| |
| ChEMBL_Ref = {{ebicite||EBI}} |
||
| ChEMBL = 1210954 |
| ChEMBL = 1210954 |
||
| PubChem = 65958 |
| PubChem = 65958 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = Q022B63JPM |
| UNII = Q022B63JPM |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 59361 |
| ChemSpiderID = 59361 |
||
| InChI = 1/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27) |
|||
| InChIKey = MGQLHRYJBWGORO-UHFFFAOYAR |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27) |
| StdInChI = 1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27) |
||
Line 48: | Line 47: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=20 | H=24 | F=1 | N=3 | O=4 |
| C=20 | H=24 | F=1 | N=3 | O=4 |
||
| molecular_weight = 389.42 g/mol |
|||
| smiles = CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F |
| smiles = CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F |
||
}} |
}} |
||
'''Balofloxacin''' ([[International Nonproprietary Name|INN]]) is a [[fluoroquinolone]] [[antibiotic]]. It is sold under the brand name '''Q-Roxin''' in [[Korea]], and under various names in India.<ref>{{cite journal | vauthors = Alksne L | title = Balofloxacin Choongwae | journal = Current Opinion in Investigational Drugs | volume = 4 | issue = 2 | pages = 224–9 | date = February 2003 | pmid = 12669387 }}</ref> It is not approved by the FDA for use in the United States. |
|||
== Pharmacodynamics == |
|||
Balofloxacin is a [[fluoroquinolone]] that has a broad spectrum in vitro activity against a wide range of [[Gram-positive]] and [[Gram-negative]] bacteria, with enhanced activity against Gram positive bacteria, including MRSA and Streptococcus pneumoniae.<ref>{{Cite web |title=NCATS Inxight Drugs — BALOFLOXACIN |url=https://drugs.ncats.io/drug/Q022B63JPM |access-date=2022-07-28 |website=drugs.ncats.io |language=en}}</ref> It functions by inhibiting the action of DNA-gyrase, preventing bacterial cells from reproducing or repairing themselves, resulting in cellular death.<ref name=":1">{{Cite web |title=BALOFLOXACINhome: Uses, Side Effects and Medicines {{!}} Apollo Pharmacy |url=https://www.apollopharmacy.in/salt/BALOFLOXACINhome |access-date=2022-07-28 |website=www.apollopharmacy.in}}</ref> |
|||
== Side Effects == |
|||
Vomiting, headache, dizziness, stomach pain, nausea, diarrhea and decreased liver function are the most common side effects. In rare cases, Balofloxacin can lead to or worsen tendinitis,<ref name=":1" /> and muscular damage.<ref name=":1" /> |
|||
== See also == |
|||
* [[Quinolones]] |
|||
== References == |
|||
{{reflist}} |
|||
{{QuinoloneAntiBiotics}} |
|||
[[Category:Fluoroquinolone antibiotics]] |
|||
[[Category:Phenol ethers]] |
|||
[[Category:Piperidines]] |
|||
[[Category:Cyclopropanes]] |
|||
[[Category:Carboxylic acids]] |
|||
[[Category:Aromatic ketones]] |
|||
{{antibiotic-stub}} |