Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Bekanamycin: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 461519097 of page Bekanamycin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CAS_number'). |
+ {{Cite web |last=PubChem |title=Bekanamycin |url=https://pubchem.ncbi.nlm.nih.gov/compound/439318 |access-date=2023-07-04 |website=pubchem.ncbi.nlm.nih.gov |language=en}} |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Bekanamycin|oldid=461519097}} 461519097] of page [[Bekanamycin]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| image = Bekanamycin.png |
| image = Bekanamycin.png |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|international|bekanamycin}} |
| Drugs.com = {{drugs.com|international|bekanamycin}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
Line 16: | Line 18: | ||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = Rx-only |
| legal_status = Rx-only |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite||??}} |
||
| CAS_number = |
| CAS_number = 4696-76-8 |
||
| CAS_supplemental = |
| CAS_supplemental = |
||
| ATC_prefix = |
| ATC_prefix = |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ATC_supplemental = |
| ATC_supplemental = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 15JT14C3GI |
| UNII = 15JT14C3GI |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| |
| ChEMBL = 176 |
||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 28098 |
| ChEBI = 28098 |
||
| PubChem = 439318 |
| PubChem = 439318 |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 388449 |
| ChemSpiderID = 388449 |
||
| NIAID_ChemDB = 005087 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| StdInChI = 1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
|||
⚫ | |||
| StdInChIKey = SKKLOUVUUNMCJE-FQSMHNGLSA-N |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=18 | H=37 |
| C=18 | H=37 | N=5 | O=10 |
||
⚫ | |||
| molecular_weight = 483.51 g/mol |
|||
⚫ | |||
| smiles = C1[C@@H]([C@H]([C@@H](C([C@@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)N)N |
|||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Bekanamycin''' ([[International Nonproprietary Name|INN]]; '''kanamycin B''') is an [[aminoglycoside]] [[antibiotic]].<ref>{{cite journal | vauthors = Morales MA, Castrillon JL, Hernandez DA | title = Effects of bekanamycin and dibekacin on the electrical activity of cardiac pacemaker cells | journal = Archives of Medical Research | volume = 24 | issue = 4 | pages = 339–45 | year = 1993 | pmid = 8118157 }}</ref><ref>{{Cite web |last=PubChem |title=Bekanamycin |url=https://pubchem.ncbi.nlm.nih.gov/compound/439318 |access-date=2023-07-04 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
{{AminoglycosideAntiBiotics}} |
|||
[[Category:Aminoglycoside antibiotics]] |
|||
{{antibiotic-stub}} |