Jump to content

Nemonapride: Difference between revisions

Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox vali
More detail in short description
 
(25 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{short description|Antipsychotic medication}}
{{drugbox
{{Additional citations|date=July 2022}}

{{Drugbox
⚫
| verifiedrevid =
⚫
| IUPAC_name = ''N''-(1-benzyl-2-methylpyrrolidin-3-yl)-5-chloro-2-methoxy-4-(methylamino)benzamide
⚫
| image = Nemonapride.
| width = 240

<!--Clinical data-->
| tradename = Emilace (<small>[[Japan|JP]]</small>)
| Drugs.com = {{drugs.com|international|nemonapride}}
⚫
| pregnancy_category
| legal_status = Rx-only (<small>[[Japan|JP]]</small>)
⚫
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
⚫
| bioavailability
⚫
| metabolism
⚫
| elimination_half-life
| excretion =

<!--Identifiers-->
| IUPHAR_ligand = 983
⚫
| CAS_number = 75272-39-8
⚫
| ATC_prefix = none
⚫
| ATC_suffix
⚫
| PubChem = 4452
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q88T5P3444
| UNII = Q88T5P3444
⚫
| verifiedrevid = 437194234
⚫
| IUPAC_name = ''N''-(1-benzyl-2-methylpyrrolidin-3-yl)-5-chloro-2-methoxy-4-(methylamino)benzamide
⚫
| image = Nemonapride.png
⚫
| CAS_number = 75272-39-8
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| PubChem = 4452
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01468
| KEGG = D01468
| ChemSpiderID = 4297
| C = 21 | H = 26 | Cl = 1 | N = 3 | O = 2
| ChEBI = 64217
| molecular_weight = 387.90 g/mol
| ChEMBL = 20734
⚫
| smiles = CC1C(CCN1CC2=CC=CC=C2)NC(=O)C3=CC(=C(C=C3OC)NC)Cl
| PDB_ligand = AQD
⚫
| bioavailability =

⚫
| metabolism =
<!--Chemical data-->
⚫
| elimination_half-life =
| excretion =
| =
⚫
| smiles = CC1C(CCN1CC2=CC=CC=C2)NC(=O)C3=CC(=C(C=C3OC)NC)Cl
⚫
| pregnancy_category =
| StdInChI = 1S/C21H26ClN3O2/c1-14-18(9-10-25(14)13-15-7-5-4-6-8-15)24-21(26)16-11-17(22)19(23-2)12-20(16)27-3/h4-8,11-12,14,18,23H,9-10,13H2,1-3H3,(H,24,26)
| legal_status = Rx-only
| StdInChIKey = KRVOJOCLBAAKSJ-UHFFFAOYSA-N
⚫
| routes_of_administration = Oral
}}
}}


'''Nemonapride''' ('''Emilace''') is a [[atypical antipsychotic]] approved in [[Japan]] for the treatment of [[schizophrenia]]. It was launched by [[Yamanouchi Pharmaceutical|Yamanouchi]] in 1991. Nemonapride acts as a [[D2 receptor|D<sub>2</sub>]] and [[D3 receptor|D<sub>3</sub> receptor]] [[receptor_antagonist|antagonist]], and is also a potent [[5-HT1A_receptor|5-HT<sub>1A</sub> receptor]] agonist. It has affinity for [[Sigma_receptor|sigma receptors]].
'''Nemonapride''' ('''Emilace''') is [[atypical antipsychotic]] approved in [[Japan]] for the treatment of [[schizophrenia]]. It was launched by [[Yamanouchi Pharmaceutical|Yamanouchi]] in 1991. Nemonapride acts as a [[D2 receptor|D<sub>2</sub>]] and [[D3 receptor|D<sub>3</sub> receptor]] [[receptor_antagonist|antagonist]], and is also a potent [[5-HT1A_receptor|5-HT<sub>1A</sub> receptor]] agonist. It has affinity for [[Sigma_receptor|sigma receptors]].


== See also ==
== See also ==
* [[Typical antipsychotic]]
* [[Benzamide]]
* [[Benzamide]]


== References ==
== References ==
{{Reflist|2}}
{{Reflist}}
{{Unreferenced|date=November 2009}}



{{Antipsychotics}}
{{Antipsychotics}}
{{Navboxes
{{Dopaminergics}}
| title = [[Pharmacodynamics]]
| titlestyle = background:#ccccff
| list1 =
{{Dopamine receptor modulators}}
{{Serotonin receptor modulators}}
{{Sigma receptor modulators}}
}}


[[Category:Pyrrolidines]]
[[Category:]]
[[Category:Benzamides]]
[[Category:Benzamides]]
[[Category:Chloroarenes]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Organochlorides]]
[[Category:]]



{{nervous-system-drug-stub}}
{{nervous-system-drug-stub}}

[[ja:ネモナプリド]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"