Tetroxoprim: Difference between revisions

{{Short description|Chemical compound}}

{{refimprove|date=August 2014}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408927686

| IUPAC_name = 5-[3,5--4-(2-methoxyethoxy)benzyl]pyrimidine-2,4-diamine

| image = Tetroxoprim.svg

<!--Clinical data-->

| tradename =

|

| pregnancy_US = <!-- A / B / C / D / X -->

| =

| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->

| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 53808-87-0

| ATC_prefix = J01

| ATC_suffix = EE06

| ATC_supplemental = (with [[sulfadiazine]])

| PubChem = 65450

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 5R6712AY0K

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06097

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 32039

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 58910

<!--Chemical data-->

| chemical_formula =

| C=16 | H=22 | N=4 | O=4

| smiles = COCCOC1=C(C=C(C=C1OC)CC2=CN=C(N=C2N)N)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H22N4O4/c1-21-4-5-24-14-12(22-2)7-10(8-13(14)23-3)6-11-9-19-16(18)20-15(11)17/h7-9H,4-6H2,1-3H3,(H4,17,18,19,20)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = WSWJIZXMAUYHOE-UHFFFAOYSA-N

'''Tetroxoprim''' ([[International Nonproprietary Name|INN]]) is a derivative of [[trimethoprim]]. It was first described in 1979.<ref>{{cite journal |=Aschhoff HS, Vergin H |title=Tetroxoprim—a new inhibitor of bacterial dihydrofolate reductase |journal=J Antimicrob Chemother |volume=5 |issue=B |pages=19–25 |=1979 |pmid=43863 |doi= }}</ref>

Its chemical formula is C=16 | H=22 | N=4 | O=4. <ref name="auto">{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/65450|title=Tetroxoprim|website=pubchem.ncbi.nlm.nih.gov}}</ref><ref name="auto1">{{Cite web|url=https://www.sciencedirect.com/topics/nursing-and-health-professions/tetroxoprim|title=Tetroxoprim - an overview &#124; ScienceDirect Topics|website=www.sciencedirect.com}}</ref>

[[Category: reductase inhibitors]]

[[Category:]]

{{antibiotic-stub}}